C23H24O5 — CID 3664205
2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetic acid (PubChem CID 3664205) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetic acid.
| Compound Name | 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetic acid |
|---|---|
| PubChem CID | 3664205 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetic acid |
| SMILES | CCCCCCc1cc2c(-c3ccccc3)cc(=O)oc2cc1OCC(=O)O |
| InChI | InChI=1S/C23H24O5/c1-2-3-4-6-11-17-12-19-18(16-9-7-5-8-10-16)13-23(26)28-21(19)14-20(17)27-15-22(24)25/h5,7-10,12-14H,2-4,6,11,15H2,1H3,(H,24,25) |
| InChIKey | HLGNZLASKJTZFQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|