C23H23O5- — CID 7150050
2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetate (PubChem CID 7150050) has the molecular formula C23H23O5- and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetate.
| Compound Name | 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 7150050 |
| Molecular Formula | C23H23O5- |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(6-hexyl-2-oxo-4-phenylchromen-7-yl)oxyacetate |
| SMILES | CCCCCCc1cc2c(-c3ccccc3)cc(=O)oc2cc1OCC(=O)[O-] |
| InChI | InChI=1S/C23H24O5/c1-2-3-4-6-11-17-12-19-18(16-9-7-5-8-10-16)13-23(26)28-21(19)14-20(17)27-15-22(24)25/h5,7-10,12-14H,2-4,6,11,15H2,1H3,(H,24,25)/p-1 |
| InChIKey | HLGNZLASKJTZFQ-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|