C21H26N2O3 — CID 70784436
1-[1-[4-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 70784436) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[1-[4-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 1-[1-[4-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 70784436 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[1-[4-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | CC[C@H]1COCCN1C(=O)c1ccc(-n2c(C)cc(C(C)=O)c2C)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-5-18-13-26-11-10-22(18)21(25)17-6-8-19(9-7-17)23-14(2)12-20(15(23)3)16(4)24/h6-9,12,18H,5,10-11,13H2,1-4H3/t18-/m0/s1 |
| InChIKey | SDYNVYQICZFKPF-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|