C25H33N3O4 — CID 154907133
acetic acid;(3-ethylmorpholin-4-yl)-[4-(3-piperazin-1-ylphenyl)phenyl]methanone (PubChem CID 154907133) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is acetic acid;(3-ethylmorpholin-4-yl)-[4-(3-piperazin-1-ylphenyl)phenyl]methanone.
| Compound Name | acetic acid;(3-ethylmorpholin-4-yl)-[4-(3-piperazin-1-ylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 154907133 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | acetic acid;(3-ethylmorpholin-4-yl)-[4-(3-piperazin-1-ylphenyl)phenyl]methanone |
| SMILES | CC(=O)O.CCC1COCCN1C(=O)c1ccc(-c2cccc(N3CCNCC3)c2)cc1 |
| InChI | InChI=1S/C23H29N3O2.C2H4O2/c1-2-21-17-28-15-14-26(21)23(27)19-8-6-18(7-9-19)20-4-3-5-22(16-20)25-12-10-24-11-13-25;1-2(3)4/h3-9,16,21,24H,2,10-15,17H2,1H3;1H3,(H,3,4) |
| InChIKey | QZOXYJVLSMRDEL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |