C18H30N2O4S — CID 70785473
2-methoxy-N-(3-methoxypropyl)-4-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 70785473) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-methoxy-N-(3-methoxypropyl)-4-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-N-(3-methoxypropyl)-4-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 70785473 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-methoxy-N-(3-methoxypropyl)-4-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | COCCCN(C1CCN(C)CC1)S(=O)(=O)c1ccc(C)cc1OC |
| InChI | InChI=1S/C18H30N2O4S/c1-15-6-7-18(17(14-15)24-4)25(21,22)20(10-5-13-23-3)16-8-11-19(2)12-9-16/h6-7,14,16H,5,8-13H2,1-4H3 |
| InChIKey | YXOXTCOTDYHRLZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|