C17H23ClN6O — CID 70786137
1-(2-aminoethyl)-N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]triazole-4-carboxamide (PubChem CID 70786137) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 70786137 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-(2-aminoethyl)-N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]triazole-4-carboxamide |
| SMILES | NCCn1cc(C(=O)NCC(c2ccccc2Cl)N2CCCC2)nn1 |
| InChI | InChI=1S/C17H23ClN6O/c18-14-6-2-1-5-13(14)16(23-8-3-4-9-23)11-20-17(25)15-12-24(10-7-19)22-21-15/h1-2,5-6,12,16H,3-4,7-11,19H2,(H,20,25) |
| InChIKey | PLUWDPYNJQCHRZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |