C19H23NO4 — CID 70792344
[3-[(4-hydroxycyclohexyl)methoxy]phenyl]-[3-(hydroxymethyl)pyrrol-1-yl]methanone (PubChem CID 70792344) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [3-[(4-hydroxycyclohexyl)methoxy]phenyl]-[3-(hydroxymethyl)pyrrol-1-yl]methanone.
| Compound Name | [3-[(4-hydroxycyclohexyl)methoxy]phenyl]-[3-(hydroxymethyl)pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 70792344 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [3-[(4-hydroxycyclohexyl)methoxy]phenyl]-[3-(hydroxymethyl)pyrrol-1-yl]methanone |
| SMILES | O=C(c1cccc(OCC2CCC(O)CC2)c1)n1ccc(CO)c1 |
| InChI | InChI=1S/C19H23NO4/c21-12-15-8-9-20(11-15)19(23)16-2-1-3-18(10-16)24-13-14-4-6-17(22)7-5-14/h1-3,8-11,14,17,21-22H,4-7,12-13H2 |
| InChIKey | YMXVHTZCQAZKAJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |