C28H45N3O — CID 70792439
(2S)-1-[4-(9-cyclohexylnonyl)benzoyl]-N'-methylpyrrolidine-2-carboximidamide (PubChem CID 70792439) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is (2S)-1-[4-(9-cyclohexylnonyl)benzoyl]-N'-methylpyrrolidine-2-carboximidamide.
| Compound Name | (2S)-1-[4-(9-cyclohexylnonyl)benzoyl]-N'-methylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 70792439 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | (2S)-1-[4-(9-cyclohexylnonyl)benzoyl]-N'-methylpyrrolidine-2-carboximidamide |
| SMILES | C/N=C(\N)[C@@H]1CCCN1C(=O)c1ccc(CCCCCCCCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C28H45N3O/c1-30-27(29)26-17-12-22-31(26)28(32)25-20-18-24(19-21-25)16-9-6-4-2-3-5-8-13-23-14-10-7-11-15-23/h18-21,23,26H,2-17,22H2,1H3,(H2,29,30)/t26-/m0/s1 |
| InChIKey | XOZXJFASVQQCCQ-SANMLTNESA-N |
| XLogP | 6.52 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|