C26H41NO2 — CID 129239353
[4-[7-(cyclohexylmethoxy)heptyl]phenyl]-[(2R)-2-methylpyrrolidin-1-yl]methanone (PubChem CID 129239353) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is [4-[7-(cyclohexylmethoxy)heptyl]phenyl]-[(2R)-2-methylpyrrolidin-1-yl]methanone.
| Compound Name | [4-[7-(cyclohexylmethoxy)heptyl]phenyl]-[(2R)-2-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129239353 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | [4-[7-(cyclohexylmethoxy)heptyl]phenyl]-[(2R)-2-methylpyrrolidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCN1C(=O)c1ccc(CCCCCCCOCC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H41NO2/c1-22-11-10-19-27(22)26(28)25-17-15-23(16-18-25)12-6-3-2-4-9-20-29-21-24-13-7-5-8-14-24/h15-18,22,24H,2-14,19-21H2,1H3/t22-/m1/s1 |
| InChIKey | FANRHURTPGPFFC-JOCHJYFZSA-N |
| XLogP | 6.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|