C26H39NO2 — CID 158184364
1-[1-(1-aminoethenyl)cyclopropyl]-2-[4-[6-(cyclohexylmethoxy)hexyl]phenyl]ethanone (PubChem CID 158184364) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 1-[1-(1-aminoethenyl)cyclopropyl]-2-[4-[6-(cyclohexylmethoxy)hexyl]phenyl]ethanone.
| Compound Name | 1-[1-(1-aminoethenyl)cyclopropyl]-2-[4-[6-(cyclohexylmethoxy)hexyl]phenyl]ethanone |
|---|---|
| PubChem CID | 158184364 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 1-[1-(1-aminoethenyl)cyclopropyl]-2-[4-[6-(cyclohexylmethoxy)hexyl]phenyl]ethanone |
| SMILES | C=C(N)C1(C(=O)Cc2ccc(CCCCCCOCC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H39NO2/c1-21(27)26(16-17-26)25(28)19-23-14-12-22(13-15-23)9-5-2-3-8-18-29-20-24-10-6-4-7-11-24/h12-15,24H,1-11,16-20,27H2 |
| InChIKey | NSDWHTRHYANGAD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|