C26H40N2O3 — CID 172984941
1-[2-[4-[7-(cyclohexylmethoxy)heptyl]phenyl]acetyl]-N'-hydroxycyclopropane-1-carboximidamide (PubChem CID 172984941) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-[2-[4-[7-(cyclohexylmethoxy)heptyl]phenyl]acetyl]-N'-hydroxycyclopropane-1-carboximidamide.
| Compound Name | 1-[2-[4-[7-(cyclohexylmethoxy)heptyl]phenyl]acetyl]-N'-hydroxycyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 172984941 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 1-[2-[4-[7-(cyclohexylmethoxy)heptyl]phenyl]acetyl]-N'-hydroxycyclopropane-1-carboximidamide |
| SMILES | N/C(=N\O)C1(C(=O)Cc2ccc(CCCCCCCOCC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H40N2O3/c27-25(28-30)26(16-17-26)24(29)19-22-14-12-21(13-15-22)9-5-2-1-3-8-18-31-20-23-10-6-4-7-11-23/h12-15,23,30H,1-11,16-20H2,(H2,27,28) |
| InChIKey | NGWDCTJWZIOOPS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|