C29H43N3O3 — CID 129231663
4-[7-(1-adamantylmethoxy)heptyl]-N-[1-[(Z)-N'-hydroxycarbamimidoyl]cyclopropyl]benzamide (PubChem CID 129231663) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is 4-[7-(1-adamantylmethoxy)heptyl]-N-[1-[(Z)-N'-hydroxycarbamimidoyl]cyclopropyl]benzamide.
| Compound Name | 4-[7-(1-adamantylmethoxy)heptyl]-N-[1-[(Z)-N'-hydroxycarbamimidoyl]cyclopropyl]benzamide |
|---|---|
| PubChem CID | 129231663 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 4-[7-(1-adamantylmethoxy)heptyl]-N-[1-[(Z)-N'-hydroxycarbamimidoyl]cyclopropyl]benzamide |
| SMILES | N/C(=N\O)C1(NC(=O)c2ccc(CCCCCCCOCC34CC5CC(CC(C5)C3)C4)cc2)CC1 |
| InChI | InChI=1S/C29H43N3O3/c30-27(32-34)29(11-12-29)31-26(33)25-9-7-21(8-10-25)6-4-2-1-3-5-13-35-20-28-17-22-14-23(18-28)16-24(15-22)19-28/h7-10,22-24,34H,1-6,11-20H2,(H2,30,32)(H,31,33) |
| InChIKey | JXVZASKGNBTZAZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|