C21H33N3O2 — CID 123533155
4-decyl-N-[1-(N'-hydroxycarbamimidoyl)cyclopropyl]benzamide (PubChem CID 123533155) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-decyl-N-[1-(N'-hydroxycarbamimidoyl)cyclopropyl]benzamide.
| Compound Name | 4-decyl-N-[1-(N'-hydroxycarbamimidoyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 123533155 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-decyl-N-[1-(N'-hydroxycarbamimidoyl)cyclopropyl]benzamide |
| SMILES | CCCCCCCCCCc1ccc(C(=O)NC2(C(N)=NO)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-2-3-4-5-6-7-8-9-10-17-11-13-18(14-12-17)19(25)23-21(15-16-21)20(22)24-26/h11-14,26H,2-10,15-16H2,1H3,(H2,22,24)(H,23,25) |
| InChIKey | VPWUWWKQEPKJIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|