C18H17N5O2 — CID 707930
(E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 707930) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 707930 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc(N)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H17N5O2/c1-25-15-10-7-13(8-11-15)9-12-16(24)20-18-21-17(19)23(22-18)14-5-3-2-4-6-14/h2-12H,1H3,(H3,19,20,21,22,24)/b12-9+ |
| InChIKey | RXLGAYPRAKOXRT-FMIVXFBMSA-N |
| XLogP | 2.51 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|