C21H21NO7S — CID 70793313
2-[(4-methylphenyl)sulfonylamino]-2-(5,7,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-14-yl)acetic acid (PubChem CID 70793313) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-2-(5,7,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-14-yl)acetic acid.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-2-(5,7,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-14-yl)acetic acid |
|---|---|
| PubChem CID | 70793313 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-2-(5,7,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-14-yl)acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)O)C2CC3Cc4cc5c(cc4C2O3)OCO5)cc1 |
| InChI | InChI=1S/C21H21NO7S/c1-11-2-4-14(5-3-11)30(25,26)22-19(21(23)24)16-8-13-6-12-7-17-18(28-10-27-17)9-15(12)20(16)29-13/h2-5,7,9,13,16,19-20,22H,6,8,10H2,1H3,(H,23,24) |
| InChIKey | BGIGTSYUMZAYIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |