C23H25N5O4S — CID 70794899
[(6S)-3-amino-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate (PubChem CID 70794899) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is [(6S)-3-amino-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate.
| Compound Name | [(6S)-3-amino-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 70794899 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [(6S)-3-amino-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OC[C@H]2CCc3c(sc(NC(=O)/C=C/c4cccnc4)c3N)C2)no1 |
| InChI | InChI=1S/C23H25N5O4S/c1-14-9-17(28-32-14)12-26-23(30)31-13-16-4-6-18-19(10-16)33-22(21(18)24)27-20(29)7-5-15-3-2-8-25-11-15/h2-3,5,7-9,11,16H,4,6,10,12-13,24H2,1H3,(H,26,30)(H,27,29)/b7-5+/t16-/m0/s1 |
| InChIKey | MMPDRUSBQWMCQE-YERXGYGTSA-N |
| XLogP | 3.70 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|