C24H29N5O4S — CID 70794882
[3-amino-2-(3-pyridin-3-ylbutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate (PubChem CID 70794882) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is [3-amino-2-(3-pyridin-3-ylbutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate.
| Compound Name | [3-amino-2-(3-pyridin-3-ylbutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 70794882 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [3-amino-2-(3-pyridin-3-ylbutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OCC2CCc3c(sc(NC(=O)CC(C)c4cccnc4)c3N)C2)no1 |
| InChI | InChI=1S/C24H29N5O4S/c1-14(17-4-3-7-26-11-17)8-21(30)28-23-22(25)19-6-5-16(10-20(19)34-23)13-32-24(31)27-12-18-9-15(2)33-29-18/h3-4,7,9,11,14,16H,5-6,8,10,12-13,25H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | AFCSXGHCHKFYEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |