C28H32N4O4S — CID 89294990
[3-ethynyl-2-[3-(3-hydroxyphenyl)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate (PubChem CID 89294990) has the molecular formula C28H32N4O4S and a molecular weight of 520.66 g/mol. Its IUPAC name is [3-ethynyl-2-[3-(3-hydroxyphenyl)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate.
| Compound Name | [3-ethynyl-2-[3-(3-hydroxyphenyl)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 89294990 |
| Molecular Formula | C28H32N4O4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [3-ethynyl-2-[3-(3-hydroxyphenyl)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate |
| SMILES | C#Cc1c(NC(=O)CC(C)c2cccc(O)c2)sc2c1CCC(COC(=O)NCc1cc(C)nn1C)C2 |
| InChI | InChI=1S/C28H32N4O4S/c1-5-23-24-10-9-19(16-36-28(35)29-15-21-12-18(3)31-32(21)4)13-25(24)37-27(23)30-26(34)11-17(2)20-7-6-8-22(33)14-20/h1,6-8,12,14,17,19,33H,9-11,13,15-16H2,2-4H3,(H,29,35)(H,30,34) |
| InChIKey | WVWHFOACFHDPCN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|