C14H13N3O4 — CID 7079872
methyl (3aR,6aS)-5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 7079872) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is methyl (3aR,6aS)-5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl (3aR,6aS)-5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7079872 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl (3aR,6aS)-5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C14H13N3O4/c1-21-14(20)11-9-10(15-16-11)13(19)17(12(9)18)7-8-5-3-2-4-6-8/h2-6,9-10,15H,7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | FIUVEANVUFVUGG-ZJUUUORDSA-N |
| XLogP | -0.33 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|