C26H21N3O3 — CID 98199550
(3aR,6aS)-5-benzyl-3-(2,2-diphenylacetyl)-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98199550) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is (3aR,6aS)-5-benzyl-3-(2,2-diphenylacetyl)-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-benzyl-3-(2,2-diphenylacetyl)-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98199550 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3aR,6aS)-5-benzyl-3-(2,2-diphenylacetyl)-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C(C1=NN[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]12)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O3/c30-24(20(18-12-6-2-7-13-18)19-14-8-3-9-15-19)22-21-23(28-27-22)26(32)29(25(21)31)16-17-10-4-1-5-11-17/h1-15,20-21,23,28H,16H2/t21-,23-/m0/s1 |
| InChIKey | WVPCNPCGPJGYDE-GMAHTHKFSA-N |
| XLogP | 2.90 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|