C39H28N4O2 — CID 70803526
2-[3-[7-[3-(6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 70803526) has the molecular formula C39H28N4O2 and a molecular weight of 584.68 g/mol. Its IUPAC name is 2-[3-[7-[3-(6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-[3-[7-[3-(6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 70803526 |
| Molecular Formula | C39H28N4O2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-[3-[7-[3-(6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CC1(C)c2cc(-c3cccc(-c4nc5c(o4)CCC=N5)c3)ccc2-c2ccc(-c3cccc(-c4nc5ncccc5o4)c3)cc21 |
| InChI | InChI=1S/C39H28N4O2/c1-39(2)31-21-25(23-7-3-9-27(19-23)37-42-35-33(44-37)11-5-17-40-35)13-15-29(31)30-16-14-26(22-32(30)39)24-8-4-10-28(20-24)38-43-36-34(45-38)12-6-18-41-36/h3-5,7-11,13-22H,6,12H2,1-2H3 |
| InChIKey | ATKUNQJZVVKESH-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |