C21H29N7 — CID 70806616
3-methyl-5-N-(3-piperidin-1-ylpropyl)-7-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 70806616) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-methyl-5-N-(3-piperidin-1-ylpropyl)-7-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 3-methyl-5-N-(3-piperidin-1-ylpropyl)-7-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 70806616 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-methyl-5-N-(3-piperidin-1-ylpropyl)-7-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | Cc1cnn2c(NCc3cccnc3)cc(NCCCN3CCCCC3)nc12 |
| InChI | InChI=1S/C21H29N7/c1-17-14-25-28-20(24-16-18-7-5-8-22-15-18)13-19(26-21(17)28)23-9-6-12-27-10-3-2-4-11-27/h5,7-8,13-15,24H,2-4,6,9-12,16H2,1H3,(H,23,26) |
| InChIKey | FMPXMJLOUQTMCQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|