C13H18F2N2O2S — CID 70811146
(3S)-1-[4-(difluoromethyl)-2-methylphenyl]sulfonyl-3-methylpiperazine (PubChem CID 70811146) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is (3S)-1-[4-(difluoromethyl)-2-methylphenyl]sulfonyl-3-methylpiperazine.
| Compound Name | (3S)-1-[4-(difluoromethyl)-2-methylphenyl]sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 70811146 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3S)-1-[4-(difluoromethyl)-2-methylphenyl]sulfonyl-3-methylpiperazine |
| SMILES | Cc1cc(C(F)F)ccc1S(=O)(=O)N1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-9-7-11(13(14)15)3-4-12(9)20(18,19)17-6-5-16-10(2)8-17/h3-4,7,10,13,16H,5-6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZWUHXKMMADSTFZ-JTQLQIEISA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |