C22H28N2O — CID 70811783
2-(2,2-dimethylbutyl)-3-methyl-N-(1-pyridin-2-ylcyclopropyl)benzamide (PubChem CID 70811783) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(2,2-dimethylbutyl)-3-methyl-N-(1-pyridin-2-ylcyclopropyl)benzamide.
| Compound Name | 2-(2,2-dimethylbutyl)-3-methyl-N-(1-pyridin-2-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 70811783 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-(2,2-dimethylbutyl)-3-methyl-N-(1-pyridin-2-ylcyclopropyl)benzamide |
| SMILES | CCC(C)(C)Cc1c(C)cccc1C(=O)NC1(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H28N2O/c1-5-21(3,4)15-18-16(2)9-8-10-17(18)20(25)24-22(12-13-22)19-11-6-7-14-23-19/h6-11,14H,5,12-13,15H2,1-4H3,(H,24,25) |
| InChIKey | CMAMFIUCGXGADH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |