C22H25NO3 — CID 70813717
ethyl 2-[(2-methylpropan-2-yl)oxy]-2-(1-phenylindol-2-yl)acetate (PubChem CID 70813717) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxy]-2-(1-phenylindol-2-yl)acetate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxy]-2-(1-phenylindol-2-yl)acetate |
|---|---|
| PubChem CID | 70813717 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxy]-2-(1-phenylindol-2-yl)acetate |
| SMILES | CCOC(=O)C(OC(C)(C)C)c1cc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-5-25-21(24)20(26-22(2,3)4)19-15-16-11-9-10-14-18(16)23(19)17-12-7-6-8-13-17/h6-15,20H,5H2,1-4H3 |
| InChIKey | BTMPQAOZWBZSAV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |