C19H24O3 — CID 141324526
ethyl (2S)-2-(3-methylnaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 141324526) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (2S)-2-(3-methylnaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl (2S)-2-(3-methylnaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 141324526 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | ethyl (2S)-2-(3-methylnaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)[C@@H](OC(C)(C)C)c1cc2ccccc2cc1C |
| InChI | InChI=1S/C19H24O3/c1-6-21-18(20)17(22-19(3,4)5)16-12-15-10-8-7-9-14(15)11-13(16)2/h7-12,17H,6H2,1-5H3/t17-/m0/s1 |
| InChIKey | HPAOFSVYRDWCKY-KRWDZBQOSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |