C25H32O3 — CID 123410601
ethyl 2-[1-(cyclohexen-1-yl)-3-methylnaphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 123410601) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is ethyl 2-[1-(cyclohexen-1-yl)-3-methylnaphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[1-(cyclohexen-1-yl)-3-methylnaphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 123410601 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl 2-[1-(cyclohexen-1-yl)-3-methylnaphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)C(OC(C)(C)C)c1c(C)cc2ccccc2c1C1=CCCCC1 |
| InChI | InChI=1S/C25H32O3/c1-6-27-24(26)23(28-25(3,4)5)21-17(2)16-19-14-10-11-15-20(19)22(21)18-12-8-7-9-13-18/h10-12,14-16,23H,6-9,13H2,1-5H3 |
| InChIKey | DREZYPKNWJPLPE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |