C25H25NO2 — CID 158219891
(1S)-1-[1-(3-isocyanophenyl)-3-methylnaphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one (PubChem CID 158219891) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (1S)-1-[1-(3-isocyanophenyl)-3-methylnaphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one.
| Compound Name | (1S)-1-[1-(3-isocyanophenyl)-3-methylnaphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 158219891 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (1S)-1-[1-(3-isocyanophenyl)-3-methylnaphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
| SMILES | [C-]#[N+]c1cccc(-c2c([C@H](OC(C)(C)C)C(C)=O)c(C)cc3ccccc23)c1 |
| InChI | InChI=1S/C25H25NO2/c1-16-14-18-10-7-8-13-21(18)23(19-11-9-12-20(15-19)26-6)22(16)24(17(2)27)28-25(3,4)5/h7-15,24H,1-5H3/t24-/m1/s1 |
| InChIKey | RKROANJMTUINRY-XMMPIXPASA-N |
| XLogP | 6.81 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|