C21H21ClF2N4O2 — CID 70816892
1-[[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)urea (PubChem CID 70816892) has the molecular formula C21H21ClF2N4O2 and a molecular weight of 434.87 g/mol. Its IUPAC name is 1-[[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)urea.
| Compound Name | 1-[[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 70816892 |
| Molecular Formula | C21H21ClF2N4O2 |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1-[[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)urea |
| SMILES | CC(C)(C)c1cc(CNC(=O)Nc2cc(F)c(O)c(F)c2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C21H21ClF2N4O2/c1-21(2,3)18-10-15(28(27-18)14-6-4-5-12(22)7-14)11-25-20(30)26-13-8-16(23)19(29)17(24)9-13/h4-10,29H,11H2,1-3H3,(H2,25,26,30) |
| InChIKey | LNVUHXYLPWKDKC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|