C14H17Cl2N3 — CID 89036752
1-[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]-N-chloromethanamine (PubChem CID 89036752) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]-N-chloromethanamine.
| Compound Name | 1-[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]-N-chloromethanamine |
|---|---|
| PubChem CID | 89036752 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-[3-tert-butyl-1-(3-chlorophenyl)pyrazol-5-yl]-N-chloromethanamine |
| SMILES | CC(C)(C)c1cc(CNCl)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H17Cl2N3/c1-14(2,3)13-8-12(9-17-16)19(18-13)11-6-4-5-10(15)7-11/h4-8,17H,9H2,1-3H3 |
| InChIKey | XWBGCAUVQZORCW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|