C15H19N3O4S — CID 70817818
(2R)-2-methyl-4-(4-methyl-5-phenyltriazol-1-yl)-2-methylsulfonylbutanoic acid (PubChem CID 70817818) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is (2R)-2-methyl-4-(4-methyl-5-phenyltriazol-1-yl)-2-methylsulfonylbutanoic acid.
| Compound Name | (2R)-2-methyl-4-(4-methyl-5-phenyltriazol-1-yl)-2-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 70817818 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2R)-2-methyl-4-(4-methyl-5-phenyltriazol-1-yl)-2-methylsulfonylbutanoic acid |
| SMILES | Cc1nnn(CC[C@](C)(C(=O)O)S(C)(=O)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-11-13(12-7-5-4-6-8-12)18(17-16-11)10-9-15(2,14(19)20)23(3,21)22/h4-8H,9-10H2,1-3H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | WGOCITBQXLSNMH-OAHLLOKOSA-N |
| XLogP | 1.53 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |