C9H12N2O5 — CID 70820577
ethyl 3-[(2-oxo-3H-1,3-oxazole-4-carbonyl)amino]propanoate (PubChem CID 70820577) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is ethyl 3-[(2-oxo-3H-1,3-oxazole-4-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-[(2-oxo-3H-1,3-oxazole-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 70820577 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl 3-[(2-oxo-3H-1,3-oxazole-4-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1coc(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O5/c1-2-15-7(12)3-4-10-8(13)6-5-16-9(14)11-6/h5H,2-4H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | NWVPIPCCTCPCOK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |