About ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate
ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate (PubChem CID 135071112) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate |
| PubChem CID | 135071112 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1cc2scc(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C18H18N2O3S/c1-2-23-16(21)8-9-19-18(22)14-10-15-17(20-14)13(11-24-15)12-6-4-3-5-7-12/h3-7,10-11,20H,2,8-9H2,1H3,(H,19,22) |
| InChIKey | DORLCGIMUNTGAP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate?
The IUPAC name of ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate (CID 135071112) is ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate.
What is the SMILES notation for ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate?
The canonical SMILES for ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate is CCOC(=O)CCNC(=O)c1cc2scc(-c3ccccc3)c2[nH]1.
What is the InChIKey of ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate?
The InChIKey is DORLCGIMUNTGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S/c1-2-23-16(21)8-9-19-18(22)14-10-15-17(20-14)13(11-24-15)12-6-4-3-5-7-12/h3-7,10-11,20H,2,8-9H2,1H3,(H,19,22).
What are the key properties of ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate?
ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate has a molecular weight of 342.42 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(3-phenyl-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]propanoate is sourced from PubChem (CID 135071112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).