C18H20N2O5 — CID 58067176
ethyl 3-[(4-oxo-3-phenylmethoxy-1H-pyridine-2-carbonyl)amino]propanoate (PubChem CID 58067176) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 3-[(4-oxo-3-phenylmethoxy-1H-pyridine-2-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-[(4-oxo-3-phenylmethoxy-1H-pyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 58067176 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 3-[(4-oxo-3-phenylmethoxy-1H-pyridine-2-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1[nH]ccc(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O5/c1-2-24-15(22)9-11-20-18(23)16-17(14(21)8-10-19-16)25-12-13-6-4-3-5-7-13/h3-8,10H,2,9,11-12H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | XLLKNERZRBGERN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |