C31H30ClIN4O5S — CID 70821086
3-[[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(3-chloro-5-iodophenyl)pyrazol-1-yl]methyl]benzoyl]amino]propanoic acid (PubChem CID 70821086) has the molecular formula C31H30ClIN4O5S and a molecular weight of 733.03 g/mol. Its IUPAC name is 3-[[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(3-chloro-5-iodophenyl)pyrazol-1-yl]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(3-chloro-5-iodophenyl)pyrazol-1-yl]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70821086 |
| Molecular Formula | C31H30ClIN4O5S |
| Molecular Weight | 733.03 g/mol |
| Exact Mass | 732.07 |
| IUPAC Name | 3-[[4-[[5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(3-chloro-5-iodophenyl)pyrazol-1-yl]methyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(Cn2nc(-c3cc(Cl)cc(I)c3)cc2C2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H30ClIN4O5S/c32-25-16-24(17-26(33)18-25)28-19-29(22-11-14-36(15-12-22)43(41,42)27-4-2-1-3-5-27)37(35-28)20-21-6-8-23(9-7-21)31(40)34-13-10-30(38)39/h1-9,16-19,22H,10-15,20H2,(H,34,40)(H,38,39) |
| InChIKey | JAKCMNDJINIAOX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|