C18H13N2O4- — CID 7082296
4-[(10aR)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]benzoate (PubChem CID 7082296) has the molecular formula C18H13N2O4- and a molecular weight of 321.31 g/mol. Its IUPAC name is 4-[(10aR)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]benzoate.
| Compound Name | 4-[(10aR)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 7082296 |
| Molecular Formula | C18H13N2O4- |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-[(10aR)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2C(=O)[C@H]3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O4/c21-16-15-9-12-3-1-2-4-13(12)10-19(15)18(24)20(16)14-7-5-11(6-8-14)17(22)23/h1-8,15H,9-10H2,(H,22,23)/p-1/t15-/m1/s1 |
| InChIKey | DSQWDJQXFPYPEK-OAHLLOKOSA-M |
| XLogP | 0.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|