C24H18FN3O3 — CID 7581383
4-[(10aS)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(4-fluorophenyl)benzamide (PubChem CID 7581383) has the molecular formula C24H18FN3O3 and a molecular weight of 415.42 g/mol. Its IUPAC name is 4-[(10aS)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-[(10aS)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 7581383 |
| Molecular Formula | C24H18FN3O3 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[(10aS)-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(N2C(=O)[C@@H]3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C24H18FN3O3/c25-18-7-9-19(10-8-18)26-22(29)15-5-11-20(12-6-15)28-23(30)21-13-16-3-1-2-4-17(16)14-27(21)24(28)31/h1-12,21H,13-14H2,(H,26,29)/t21-/m0/s1 |
| InChIKey | YESCEBJVKLTPBQ-NRFANRHFSA-N |
| XLogP | 3.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|