C28H28N4O4 — CID 70824678
ethyl 4-(4-benzylanilino)-3-cyano-5-(2-methoxyethoxymethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate (PubChem CID 70824678) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is ethyl 4-(4-benzylanilino)-3-cyano-5-(2-methoxyethoxymethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate.
| Compound Name | ethyl 4-(4-benzylanilino)-3-cyano-5-(2-methoxyethoxymethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate |
|---|---|
| PubChem CID | 70824678 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | ethyl 4-(4-benzylanilino)-3-cyano-5-(2-methoxyethoxymethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate |
| SMILES | CCOC(=O)c1cn2ncc(C#N)c(Nc3ccc(Cc4ccccc4)cc3)c2c1COCCOC |
| InChI | InChI=1S/C28H28N4O4/c1-3-36-28(33)24-18-32-27(25(24)19-35-14-13-34-2)26(22(16-29)17-30-32)31-23-11-9-21(10-12-23)15-20-7-5-4-6-8-20/h4-12,17-18,31H,3,13-15,19H2,1-2H3 |
| InChIKey | KNBHHFSXPYDVDN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|