C14H20BNO5S — CID 70827711
[5-(1-methylsulfonylpiperidin-4-yl)-2,3-dihydro-1-benzofuran-2-yl]boronic acid (PubChem CID 70827711) has the molecular formula C14H20BNO5S and a molecular weight of 325.20 g/mol. Its IUPAC name is [5-(1-methylsulfonylpiperidin-4-yl)-2,3-dihydro-1-benzofuran-2-yl]boronic acid.
| Compound Name | [5-(1-methylsulfonylpiperidin-4-yl)-2,3-dihydro-1-benzofuran-2-yl]boronic acid |
|---|---|
| PubChem CID | 70827711 |
| Molecular Formula | C14H20BNO5S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [5-(1-methylsulfonylpiperidin-4-yl)-2,3-dihydro-1-benzofuran-2-yl]boronic acid |
| SMILES | CS(=O)(=O)N1CCC(c2ccc3c(c2)CC(B(O)O)O3)CC1 |
| InChI | InChI=1S/C14H20BNO5S/c1-22(19,20)16-6-4-10(5-7-16)11-2-3-13-12(8-11)9-14(21-13)15(17)18/h2-3,8,10,14,17-18H,4-7,9H2,1H3 |
| InChIKey | NAWRZMJPCRTRLI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|