C25H39N3O4 — CID 70830419
N-[(3S,4S)-4-[[(2-cyclohexylacetyl)amino]methyl]pyrrolidin-3-yl]-3-(3-methoxypropoxy)-4-methylbenzamide (PubChem CID 70830419) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-[(3S,4S)-4-[[(2-cyclohexylacetyl)amino]methyl]pyrrolidin-3-yl]-3-(3-methoxypropoxy)-4-methylbenzamide.
| Compound Name | N-[(3S,4S)-4-[[(2-cyclohexylacetyl)amino]methyl]pyrrolidin-3-yl]-3-(3-methoxypropoxy)-4-methylbenzamide |
|---|---|
| PubChem CID | 70830419 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | N-[(3S,4S)-4-[[(2-cyclohexylacetyl)amino]methyl]pyrrolidin-3-yl]-3-(3-methoxypropoxy)-4-methylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N[C@@H]2CNC[C@H]2CNC(=O)CC2CCCCC2)ccc1C |
| InChI | InChI=1S/C25H39N3O4/c1-18-9-10-20(14-23(18)32-12-6-11-31-2)25(30)28-22-17-26-15-21(22)16-27-24(29)13-19-7-4-3-5-8-19/h9-10,14,19,21-22,26H,3-8,11-13,15-17H2,1-2H3,(H,27,29)(H,28,30)/t21-,22+/m0/s1 |
| InChIKey | CSJZUUAHBVGMQV-FCHUYYIVSA-N |
| XLogP | 2.81 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|