C44H52N2 — CID 70831411
2,4-dimethyl-N-[2-[4-[2-[4-(N-(2-methyl-4-pentylphenyl)anilino)phenyl]ethyl]phenyl]butan-2-yl]aniline (PubChem CID 70831411) has the molecular formula C44H52N2 and a molecular weight of 608.91 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-[4-[2-[4-(N-(2-methyl-4-pentylphenyl)anilino)phenyl]ethyl]phenyl]butan-2-yl]aniline.
| Compound Name | 2,4-dimethyl-N-[2-[4-[2-[4-(N-(2-methyl-4-pentylphenyl)anilino)phenyl]ethyl]phenyl]butan-2-yl]aniline |
|---|---|
| PubChem CID | 70831411 |
| Molecular Formula | C44H52N2 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | 2,4-dimethyl-N-[2-[4-[2-[4-(N-(2-methyl-4-pentylphenyl)anilino)phenyl]ethyl]phenyl]butan-2-yl]aniline |
| SMILES | CCCCCc1ccc(N(c2ccccc2)c2ccc(CCc3ccc(C(C)(CC)Nc4ccc(C)cc4C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C44H52N2/c1-7-9-11-14-38-24-30-43(35(5)32-38)46(40-15-12-10-13-16-40)41-27-22-37(23-28-41)19-18-36-20-25-39(26-21-36)44(6,8-2)45-42-29-17-33(3)31-34(42)4/h10,12-13,15-17,20-32,45H,7-9,11,14,18-19H2,1-6H3 |
| InChIKey | PYDQZPFWXREWKS-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|