C39H50N3O7P — CID 70832845
tert-butyl (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 70832845) has the molecular formula C39H50N3O7P and a molecular weight of 703.82 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70832845 |
| Molecular Formula | C39H50N3O7P |
| Molecular Weight | 703.82 g/mol |
| Exact Mass | 703.34 |
| IUPAC Name | tert-butyl (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C[C@H]1C(=O)N1CCC[C@H]1P1OC2C3CC(CC2(C)O1)C3(C)C |
| InChI | InChI=1S/C39H50N3O7P/c1-37(2,3)47-36(45)42-21-24(40-35(44)46-22-29-27-14-9-7-12-25(27)26-13-8-10-15-28(26)29)19-31(42)34(43)41-17-11-16-32(41)50-48-33-30-18-23(38(30,4)5)20-39(33,6)49-50/h7-10,12-15,23-24,29-33H,11,16-22H2,1-6H3,(H,40,44)/t23?,24-,30?,31+,32-,33?,39?,50?/m1/s1 |
| InChIKey | XFLCPPSYWSYADE-CZXFWNRMSA-N |
| XLogP | 7.40 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.82 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|