C32H47N4O8P — CID 70832844
tert-butyl (2S,4R)-4-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 70832844) has the molecular formula C32H47N4O8P and a molecular weight of 646.72 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70832844 |
| Molecular Formula | C32H47N4O8P |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | tert-butyl (2S,4R)-4-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-2-[(2R)-2-(6,9,9-trimethyl-3,5-dioxa-4-phosphatricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC(=O)CCCN2C(=O)C=CC2=O)C[C@H]1C(=O)N1CCC[C@H]1P1OC2C3CC(CC2(C)O1)C3(C)C |
| InChI | InChI=1S/C32H47N4O8P/c1-30(2,3)42-29(41)36-18-20(33-23(37)9-7-13-34-24(38)11-12-25(34)39)16-22(36)28(40)35-14-8-10-26(35)45-43-27-21-15-19(31(21,4)5)17-32(27,6)44-45/h11-12,19-22,26-27H,7-10,13-18H2,1-6H3,(H,33,37)/t19?,20-,21?,22+,26-,27?,32?,45?/m1/s1 |
| InChIKey | RBTGVMQJUHGCRR-GIDLHAMUSA-N |
| XLogP | 3.69 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|