C23H37BN2O5 — CID 10526706
tert-butyl (2S)-2-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]azetidine-1-carboxylate (PubChem CID 10526706) has the molecular formula C23H37BN2O5 and a molecular weight of 432.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 10526706 |
| Molecular Formula | C23H37BN2O5 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)N1CCC[C@H]1B1O[C@@H]2[C@@H]3C[C@H](C[C@]2(C)O1)C3(C)C |
| InChI | InChI=1S/C23H37BN2O5/c1-21(2,3)29-20(28)25-11-9-16(25)19(27)26-10-7-8-17(26)24-30-18-15-12-14(22(15,4)5)13-23(18,6)31-24/h14-18H,7-13H2,1-6H3/t14-,15+,16+,17+,18-,23+/m1/s1 |
| InChIKey | HQHIMUOAELXGDM-NOKMQGRWSA-N |
| XLogP | 3.25 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|