C20H35BN2O3 — CID 10570614
(2S)-2-amino-3,3-dimethyl-1-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 10570614) has the molecular formula C20H35BN2O3 and a molecular weight of 362.32 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-1-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2-amino-3,3-dimethyl-1-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 10570614 |
| Molecular Formula | C20H35BN2O3 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-1-[(2R)-2-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCC[C@H]1B1O[C@@H]2[C@@H]3C[C@H](C[C@]2(C)O1)C3(C)C |
| InChI | InChI=1S/C20H35BN2O3/c1-18(2,3)15(22)17(24)23-9-7-8-14(23)21-25-16-13-10-12(19(13,4)5)11-20(16,6)26-21/h12-16H,7-11,22H2,1-6H3/t12-,13+,14+,15-,16-,20+/m1/s1 |
| InChIKey | VDTFKHITODKRTL-WRHJPHHQSA-N |
| XLogP | 2.62 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|