C33H53BN4O7 — CID 89054483
prop-1-en-2-yl N-[1-cyclohexyl-2-oxo-2-[[1-oxo-1-[[1-oxo-1-[2-[(6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]amino]propan-2-yl]amino]ethyl]carbamate (PubChem CID 89054483) has the molecular formula C33H53BN4O7 and a molecular weight of 628.62 g/mol. Its IUPAC name is prop-1-en-2-yl N-[1-cyclohexyl-2-oxo-2-[[1-oxo-1-[[1-oxo-1-[2-[(6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]amino]propan-2-yl]amino]ethyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[1-cyclohexyl-2-oxo-2-[[1-oxo-1-[[1-oxo-1-[2-[(6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]amino]propan-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 89054483 |
| Molecular Formula | C33H53BN4O7 |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | prop-1-en-2-yl N-[1-cyclohexyl-2-oxo-2-[[1-oxo-1-[[1-oxo-1-[2-[(6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]amino]propan-2-yl]amino]ethyl]carbamate |
| SMILES | C=C(C)OC(=O)NC(C(=O)NC(C)C(=O)NC(CC)C(=O)N1CCCC1B1OC2C3CC(C[C@]2(C)O1)C3(C)C)C1CCCCC1 |
| InChI | InChI=1S/C33H53BN4O7/c1-8-24(36-28(39)20(4)35-29(40)26(21-13-10-9-11-14-21)37-31(42)43-19(2)3)30(41)38-16-12-15-25(38)34-44-27-23-17-22(32(23,5)6)18-33(27,7)45-34/h20-27H,2,8-18H2,1,3-7H3,(H,35,40)(H,36,39)(H,37,42)/t20?,22?,23?,24?,25?,26?,27?,33-/m0/s1 |
| InChIKey | PUVWECDMLSFSDL-CSLJFDLQSA-N |
| XLogP | 3.85 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|