C35H45BN2O5 — CID 165382102
9H-fluoren-9-ylmethyl N-[(2S)-4-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]pentan-2-yl]carbamate (PubChem CID 165382102) has the molecular formula C35H45BN2O5 and a molecular weight of 584.57 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 165382102 |
| Molecular Formula | C35H45BN2O5 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCC[C@H]1B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C35H45BN2O5/c1-21(2)17-28(37-33(40)41-20-27-25-13-8-6-11-23(25)24-12-7-9-14-26(24)27)32(39)38-16-10-15-31(38)36-42-30-19-22-18-29(34(22,3)4)35(30,5)43-36/h6-9,11-14,21-22,27-31H,10,15-20H2,1-5H3,(H,37,40)/t22-,28-,29-,30+,31-,35-/m0/s1 |
| InChIKey | PTABJTRNONYHEF-HAKPEZLYSA-N |
| XLogP | 6.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|