C29H51BN4O6 — CID 174091494
tert-butyl N-[(2S)-6-(4-aminobutanoylamino)-1-oxo-1-[(2R)-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]hexan-2-yl]carbamate (PubChem CID 174091494) has the molecular formula C29H51BN4O6 and a molecular weight of 562.56 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-(4-aminobutanoylamino)-1-oxo-1-[(2R)-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-(4-aminobutanoylamino)-1-oxo-1-[(2R)-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 174091494 |
| Molecular Formula | C29H51BN4O6 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | tert-butyl N-[(2S)-6-(4-aminobutanoylamino)-1-oxo-1-[(2R)-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)CCCN)C(=O)N1CCC[C@H]1B1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H51BN4O6/c1-27(2,3)38-26(37)33-20(11-7-8-15-32-24(35)13-9-14-31)25(36)34-16-10-12-23(34)30-39-22-18-19-17-21(28(19,4)5)29(22,6)40-30/h19-23H,7-18,31H2,1-6H3,(H,32,35)(H,33,37)/t19-,20-,21-,22?,23-,29-/m0/s1 |
| InChIKey | HSJNZTQNONUFNC-WUANSCEASA-N |
| XLogP | 3.16 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|