C28H40BN3O5 — CID 58766969
benzyl N-[(3R,4R)-3-[(2R)-2-[(1R,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]piperidin-4-yl]carbamate (PubChem CID 58766969) has the molecular formula C28H40BN3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is benzyl N-[(3R,4R)-3-[(2R)-2-[(1R,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[(3R,4R)-3-[(2R)-2-[(1R,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 58766969 |
| Molecular Formula | C28H40BN3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | benzyl N-[(3R,4R)-3-[(2R)-2-[(1R,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine-1-carbonyl]piperidin-4-yl]carbamate |
| SMILES | CC1(C)C2C[C@H]1[C@]1(C)OB([C@@H]3CCCN3C(=O)[C@@H]3CNCC[C@H]3NC(=O)OCc3ccccc3)O[C@@H]1C2 |
| InChI | InChI=1S/C28H40BN3O5/c1-27(2)19-14-22(27)28(3)23(15-19)36-29(37-28)24-10-7-13-32(24)25(33)20-16-30-12-11-21(20)31-26(34)35-17-18-8-5-4-6-9-18/h4-6,8-9,19-24,30H,7,10-17H2,1-3H3,(H,31,34)/t19?,20-,21-,22-,23-,24+,28+/m1/s1 |
| InChIKey | XTLPYVQBASUDFR-KMJAEDDUSA-N |
| XLogP | 3.15 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|