C36H46BN3O7 — CID 70293155
benzyl 3-[[2-oxo-2-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]-phenylmethoxycarbonylamino]pyrrolidine-1-carboxylate (PubChem CID 70293155) has the molecular formula C36H46BN3O7 and a molecular weight of 643.59 g/mol. Its IUPAC name is benzyl 3-[[2-oxo-2-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]-phenylmethoxycarbonylamino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[[2-oxo-2-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]-phenylmethoxycarbonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70293155 |
| Molecular Formula | C36H46BN3O7 |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 643.34 |
| IUPAC Name | benzyl 3-[[2-oxo-2-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]-phenylmethoxycarbonylamino]pyrrolidine-1-carboxylate |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@@H]4CCCN4C(=O)CN(C(=O)OCc4ccccc4)C4CCN(C(=O)OCc5ccccc5)C4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C36H46BN3O7/c1-35(2)27-19-29(35)36(3)30(20-27)46-37(47-36)31-15-10-17-39(31)32(41)22-40(34(43)45-24-26-13-8-5-9-14-26)28-16-18-38(21-28)33(42)44-23-25-11-6-4-7-12-25/h4-9,11-14,27-31H,10,15-24H2,1-3H3/t27-,28?,29-,30+,31-,36-/m0/s1 |
| InChIKey | KJWHFLPTEQWCGX-QAVVXNKCSA-N |
| XLogP | 5.29 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|